CAS 475102-13-7 appears in our catalog under these names: (N–Boc–5–bromo–2–indolyl)boronic acid, (N-Boc-5-bromo-2-indolyl)boronic acid, 97%, 97%, (5-Bromo-1-(tert-butoxycarbonyl)-1H-indol-2-yl)boronic acid, 97%, (5-Bromo-1-(tert-butoxycarbonyl)-1H-indol-2-yl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 10g, 25g, 100g.
[5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 475102-13-7) is a chemical compound with the molecular formula C13H15BBrNO4 and a molecular weight of 339.98 g/mol. IUPAC name: [5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: RBYTXZMVOGZESQ-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrNO4 |
|---|---|
| Molecular weight | 339.98 g/mol |
| IUPAC name | [5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | RBYTXZMVOGZESQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)Br)(O)O |
Computed by PubChem (NCBI)