cas: 1032231-30-3 — see every product listed under this CAS number, including other names
(5-Bromo-2-cyanophenyl)boronic acid, 94% (CAS 1032231-30-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231136-1G |
| cas | 1032231-30-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 758.08 Pln |
| purity | 94% |
|---|---|
| delivery time | 3-4 weeks |
(5-bromo-2-cyanophenyl)boronic acid (CAS 1032231-30-3) is a chemical compound with the molecular formula C7H5BBrNO2 and a molecular weight of 225.84 g/mol. IUPAC name: (5-bromo-2-cyanophenyl)boronic acid. InChIKey: BVCIFFSGTUEHOP-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrNO2 |
|---|---|
| Molecular weight | 225.84 g/mol |
| IUPAC name | (5-bromo-2-cyanophenyl)boronic acid |
| InChIKey | BVCIFFSGTUEHOP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Br)C#N)(O)O |
Computed by PubChem (NCBI)