cas: 342013-81-4 — see every product listed under this CAS number, including other names
(5-Bromopyridin-3-yl)(morpholino)methanone 98% (CAS 342013-81-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A207864-1g |
| cas | 342013-81-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 1905.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A207864 |
(5-bromo-3-pyridinyl)-morpholin-4-ylmethanone (CAS 342013-81-4) is a chemical compound with the molecular formula C10H11BrN2O2 and a molecular weight of 271.11 g/mol. IUPAC name: (5-bromo-3-pyridinyl)-morpholin-4-ylmethanone. InChIKey: DGXAEBFHFVGRSH-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O2 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | (5-bromo-3-pyridinyl)-morpholin-4-ylmethanone |
| InChIKey | DGXAEBFHFVGRSH-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)