cas: 2738704-51-1 — see every product listed under this CAS number, including other names
(5R)-3-cyclopropyl-5-ethyl-2-oxo-pyrrolidine-3-carbonitrile, 97% (CAS 2738704-51-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F874828-100MG |
| cas | 2738704-51-1 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1023.62 Pln | |
| Fluorochem | 250mg | 1336.01 Pln | |
| Fluorochem | 500mg | 2148.22 Pln | |
| Fluorochem | 1g | 3194.73 Pln | |
| Fluorochem | 5g | 9203.03 Pln | |
| Chemat | 100mg | 520.40 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 500mg | 1082.00 Pln | |
| Chemat | 1g | 1595.60 Pln | |
| Chemat | 5g | 4691.60 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(5R)-3-cyclopropyl-5-ethyl-2-oxopyrrolidine-3-carbonitrile (CAS 2738704-51-1) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: (5R)-3-cyclopropyl-5-ethyl-2-oxopyrrolidine-3-carbonitrile. InChIKey: SZAXPOWMECBBEK-HNHGDDPOSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | (5R)-3-cyclopropyl-5-ethyl-2-oxopyrrolidine-3-carbonitrile |
| InChIKey | SZAXPOWMECBBEK-HNHGDDPOSA-N |
| SMILES | CC[C@@H]1CC(C(=O)N1)(C#N)C2CC2 |
Computed by PubChem (NCBI)