cas: 179942-45-1 — see every product listed under this CAS number, including other names
(6-((Tert-butyldimethylsilyl)oxy)naphthalen-2-yl)boronic acid, 98% (CAS 179942-45-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691655-1G |
| cas | 179942-45-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1466.17 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[6-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-yl]boronic acid (CAS 179942-45-1) is a chemical compound with the molecular formula C16H23BO3Si and a molecular weight of 302.2 g/mol. IUPAC name: [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-yl]boronic acid. InChIKey: QJXUSWJSQVIBCP-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3Si |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-yl]boronic acid |
| InChIKey | QJXUSWJSQVIBCP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)