cas: 1150114-75-2 — see every product listed under this CAS number, including other names
(6-(Pyrrolidin-1-yl)pyridin-3-yl)boronic acid, 96% (CAS 1150114-75-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218379-1G |
| cas | 1150114-75-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 789.32 Pln | |
| Fluorochem | 10g | 1513.03 Pln | |
| Fluorochem | 25g | 3288.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(6-pyrrolidin-1-yl-3-pyridinyl)boronic acid (CAS 1150114-75-2) is a chemical compound with the molecular formula C9H13BN2O2 and a molecular weight of 192.03 g/mol. IUPAC name: (6-pyrrolidin-1-yl-3-pyridinyl)boronic acid. InChIKey: XRIDMVCUHIKAFT-UHFFFAOYSA-N.
| Molecular formula | C9H13BN2O2 |
|---|---|
| Molecular weight | 192.03 g/mol |
| IUPAC name | (6-pyrrolidin-1-yl-3-pyridinyl)boronic acid |
| InChIKey | XRIDMVCUHIKAFT-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N2CCCC2)(O)O |
Computed by PubChem (NCBI)