(6-(methoxycarbonyl)-1H-indol-2-yl)boronic acid, 98%, 98%
cas: 1150114-47-8 — see every product listed under this CAS number, including other names
(6-(methoxycarbonyl)-1H-indol-2-yl)boronic acid, 98%, 98% (CAS 1150114-47-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FMU-100mg |
| cas | 1150114-47-8 |
| size | 100mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 500mg | 899.60 Pln | |
| Chemat | 1g | 1456.40 Pln | |
| Chemat | 5g | 4240.40 Pln | |
| Chemat | 10g | 7120.40 Pln | |
| Chemat | 25g | 13989.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(6-methoxycarbonyl-1H-indol-2-yl)boronic acid (CAS 1150114-47-8) is a chemical compound with the molecular formula C10H10BNO4 and a molecular weight of 219.00 g/mol. IUPAC name: (6-methoxycarbonyl-1H-indol-2-yl)boronic acid. InChIKey: NRUMZMTTWWXRDD-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO4 |
|---|---|
| Molecular weight | 219.00 g/mol |
| IUPAC name | (6-methoxycarbonyl-1H-indol-2-yl)boronic acid |
| InChIKey | NRUMZMTTWWXRDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1)C=C(C=C2)C(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(6-(Methoxycarbonyl)-1H-indol-2-yl)boronic acid, 6-(Methoxycarbonyl)indole-2-boronic acid, (6-methoxycarbonyl-1H-indol-2-yl)boronic acid, 6-Methoxycarbonyl-1H-indole-2-boronic acid, 1H-Indole-6-carboxylic acid, 2-borono-, 6-methyl ester, [6-(Methoxycarbonyl)-1H-indol-2-yl]boronic acid, (6-(Methoxycarbonyl)-1H-indol-2-yl)boronicacid, [6-(Methoxyca