cas: 1072951-99-5 — see every product listed under this CAS number, including other names
(6-Bromo-2-fluoro-3-isopropoxyphenyl)boronic acid (CAS 1072951-99-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338067-5G |
| cas | 1072951-99-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 747.67 Pln | |
| Fluorochem | 10g | 1216.26 Pln |
| delivery time | 3-4 weeks |
|---|
(6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 1072951-99-5) is a chemical compound with the molecular formula C9H11BBrFO3 and a molecular weight of 276.90 g/mol. IUPAC name: (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: JIDCDBHYZFYNSO-UHFFFAOYSA-N.
| Molecular formula | C9H11BBrFO3 |
|---|---|
| Molecular weight | 276.90 g/mol |
| IUPAC name | (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | JIDCDBHYZFYNSO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OC(C)C)Br)(O)O |
Computed by PubChem (NCBI)