cas: 374933-76-3 — see every product listed under this CAS number, including other names
(6-Bromo-benzo[b]thiophen-2-yl)-methanol 96% (CAS 374933-76-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A478509-10g |
| cas | 374933-76-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3485.38 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A478509 |
(6-bromo-1-benzothiophen-2-yl)methanol (CAS 374933-76-3) is a chemical compound with the molecular formula C9H7BrOS and a molecular weight of 243.12 g/mol. IUPAC name: (6-bromo-1-benzothiophen-2-yl)methanol. InChIKey: YGEBIGMLMWYGHE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrOS |
|---|---|
| Molecular weight | 243.12 g/mol |
| IUPAC name | (6-bromo-1-benzothiophen-2-yl)methanol |
| InChIKey | YGEBIGMLMWYGHE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=C2)CO |
Computed by PubChem (NCBI)