cas: 94838-88-7 — see every product listed under this CAS number, including other names
(6-Formylbenzo[d][1,3]dioxol-5-yl)boronic acid, 96% (CAS 94838-88-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216228-250MG |
| cas | 94838-88-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 1070.47 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(6-formyl-1,3-benzodioxol-5-yl)boronic acid (CAS 94838-88-7) is a chemical compound with the molecular formula C8H7BO5 and a molecular weight of 193.95 g/mol. IUPAC name: (6-formyl-1,3-benzodioxol-5-yl)boronic acid. InChIKey: AKEPUIJBVDGLMX-UHFFFAOYSA-N.
| Molecular formula | C8H7BO5 |
|---|---|
| Molecular weight | 193.95 g/mol |
| IUPAC name | (6-formyl-1,3-benzodioxol-5-yl)boronic acid |
| InChIKey | AKEPUIJBVDGLMX-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1C=O)OCO2)(O)O |
Computed by PubChem (NCBI)