cas: 104146-10-3 — see every product listed under this CAS number, including other names
(6R,7R)-4-Methoxybenzyl 3-(chloromethyl)-8-oxo-7-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate, 97%, 97% (CAS 104146-10-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HAAG-25g |
| cas | 104146-10-3 |
| size | 25g |
| availability | 17000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 250g | 198.80 Pln | |
| Chemat | 500g | 388.80 Pln | |
| Chemat | 1kg | 664.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-methoxyphenyl)methyl (6R,7R)-3-(chloromethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (CAS 104146-10-3) is a chemical compound with the molecular formula C24H23ClN2O5S and a molecular weight of 487.0 g/mol. IUPAC name: (4-methoxyphenyl)methyl (6R,7R)-3-(chloromethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate. InChIKey: KFCMZNUGNLCSJQ-NFBKMPQASA-N.
| Molecular formula | C24H23ClN2O5S |
|---|---|
| Molecular weight | 487.0 g/mol |
| IUPAC name | (4-methoxyphenyl)methyl (6R,7R)-3-(chloromethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChIKey | KFCMZNUGNLCSJQ-NFBKMPQASA-N |
| SMILES | COC1=CC=C(C=C1)COC(=O)C2=C(CS[C@H]3N2C(=O)[C@H]3NC(=O)CC4=CC=CC=C4)CCl |
Computed by PubChem (NCBI)