cas: 313368-85-3 — see every product listed under this CAS number, including other names
(6bR,10aS)-3-Methyl-2,3,6b,7,8,9,10,10a-octahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline, 95%, 95% (CAS 313368-85-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I6WT-100mg |
| cas | 313368-85-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1466.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (CAS 313368-85-3) is a chemical compound with the molecular formula C14H19N3 and a molecular weight of 229.32 g/mol. IUPAC name: (10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene. InChIKey: QLGUCSLWLPCOTR-RYUDHWBXSA-N.
| Molecular formula | C14H19N3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | (10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| InChIKey | QLGUCSLWLPCOTR-RYUDHWBXSA-N |
| SMILES | CN1CCN2[C@H]3CCNC[C@H]3C4=C2C1=CC=C4 |
Computed by PubChem (NCBI)