(7-fluoro-4-methoxy-1H-indol-2-yl)methanol, 97%
cas: 1378823-69-8 — see every product listed under this CAS number, including other names
(7-fluoro-4-methoxy-1H-indol-2-yl)methanol, 97% (CAS 1378823-69-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A883109-1g |
| cas | 1378823-69-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8448.37 Pln | |
| AmBeed | 10g | 26930.26 Pln | |
| AmBeed | 5g | 16182.25 Pln | |
| Fluorochem | 100mg | 1414.10 Pln | |
| Fluorochem | 250mg | 2314.83 Pln | |
| Fluorochem | 500mg | 3809.09 Pln | |
| Fluorochem | 1g | 5673.02 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(7-fluoro-4-methoxy-1H-indol-2-yl)methanol (CAS 1378823-69-8) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: (7-fluoro-4-methoxy-1H-indol-2-yl)methanol. InChIKey: NQTCCXWLUWOTAN-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | (7-fluoro-4-methoxy-1H-indol-2-yl)methanol |
| InChIKey | NQTCCXWLUWOTAN-UHFFFAOYSA-N |
| SMILES | COC1=C2C=C(NC2=C(C=C1)F)CO |
Computed by PubChem (NCBI)