(8-Chloronaphthalen-1-yl)boronic acid, 97%
cas: 2305022-53-9 — see every product listed under this CAS number, including other names
(8-Chloronaphthalen-1-yl)boronic acid, 97% (CAS 2305022-53-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F606908-250MG |
| cas | 2305022-53-9 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 961.14 Pln | |
| Fluorochem | 5g | 2830.27 Pln | |
| Fluorochem | 10g | 5548.06 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 2745.56 Pln | |
| Ambeed | 10g | 5421.12 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 923.60 Pln | |
| Chemat | 5g | 3078.80 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 964.13 Pln | |
| BLDpharm | 5g | 2957.87 Pln | |
| BLDpharm | 10g | 5840.19 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(8-chloronaphthalen-1-yl)boronic acid (CAS 2305022-53-9) is a chemical compound with the molecular formula C10H8BClO2 and a molecular weight of 206.43 g/mol. IUPAC name: (8-chloronaphthalen-1-yl)boronic acid. InChIKey: LAKQJVVXANSQKZ-UHFFFAOYSA-N.
| Molecular formula | C10H8BClO2 |
|---|---|
| Molecular weight | 206.43 g/mol |
| IUPAC name | (8-chloronaphthalen-1-yl)boronic acid |
| InChIKey | LAKQJVVXANSQKZ-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=CC=C2Cl)(O)O |
Computed by PubChem (NCBI)