cas: 25387-93-3 — see every product listed under this CAS number, including other names
(8-Quinolinolato)lithium, >98.0%(HPLC)(T) (CAS 25387-93-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | Q0100-1G |
| cas | 25387-93-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 177.35 Pln | |
| TCI | 5g | 521.56 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Lithium quinolin-8-olate (CAS 25387-93-3) is a chemical compound with the molecular formula C9H6LiNO and a molecular weight of 151.1 g/mol. IUPAC name: lithium quinolin-8-olate. InChIKey: FQHFBFXXYOQXMN-UHFFFAOYSA-M.
| Molecular formula | C9H6LiNO |
|---|---|
| Molecular weight | 151.1 g/mol |
| IUPAC name | lithium quinolin-8-olate |
| InChIKey | FQHFBFXXYOQXMN-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC2=C(C(=C1)[O-])N=CC=C2 |
Computed by PubChem (NCBI)