cas: 1207750-07-9 — see every product listed under this CAS number, including other names
(8-fluoro-3-quinolinyl)boronic acid, 95+% (CAS 1207750-07-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F385716-100MG |
| cas | 1207750-07-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 1341.21 Pln | |
| Fluorochem | 5g | 4413.05 Pln | |
| Fluorochem | 10g | 6870.52 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2334.80 Pln | |
| Chemat | 10g | 3702.80 Pln |
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(8-fluoroquinolin-3-yl)boronic acid (CAS 1207750-07-9) is a chemical compound with the molecular formula C9H7BFNO2 and a molecular weight of 190.97 g/mol. IUPAC name: (8-fluoroquinolin-3-yl)boronic acid. InChIKey: HWUTVRYZDFZBJZ-UHFFFAOYSA-N.
| Molecular formula | C9H7BFNO2 |
|---|---|
| Molecular weight | 190.97 g/mol |
| IUPAC name | (8-fluoroquinolin-3-yl)boronic acid |
| InChIKey | HWUTVRYZDFZBJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C(=CC=C2)F)N=C1)(O)O |
Computed by PubChem (NCBI)