cas: 2940876-68-4 — see every product listed under this CAS number, including other names
(8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine,bis(4-methylbenzenesulfonic acid), 97%, 97% (CAS 2940876-68-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13AH9I-100mg |
| cas | 2940876-68-4 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 500mg | 429.20 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 1715.60 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 25g | 5574.80 Pln | |
| Chemat | 100g | 15381.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;bis(4-methylbenzenesulfonic acid) (CAS 2940876-68-4) is a chemical compound with the molecular formula C21H30N2O6S2 and a molecular weight of 470.6 g/mol. IUPAC name: (8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;bis(4-methylbenzenesulfonic acid). InChIKey: NAQRFEKUJQDMAX-XCUBXKJBSA-N.
| Molecular formula | C21H30N2O6S2 |
|---|---|
| Molecular weight | 470.6 g/mol |
| IUPAC name | (8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;bis(4-methylbenzenesulfonic acid) |
| InChIKey | NAQRFEKUJQDMAX-XCUBXKJBSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)O.C1C[C@@H]2CNCCN2C1 |
Computed by PubChem (NCBI)