cas: 562827-16-1 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl 3-bromo-4-oxopiperidine-1-carboxylate, 97% (CAS 562827-16-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg. Offered by: AmBeed, Chemat, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A366912-1g |
| cas | 562827-16-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 5649.07 Pln | |
| AmBeed | 5g | 27958.84 Pln | |
| Chemat | 100mg | 1053.20 Pln | |
| Chemat | 250mg | 1653.20 Pln | |
| Chemat | 500mg | 2709.20 Pln | |
| Chemat | 1g | 4029.20 Pln | |
| Fluorochem | 100mg | 1945.17 Pln | |
| Fluorochem | 250mg | 3080.18 Pln | |
| Fluorochem | 500mg | 5017.00 Pln | |
| Fluorochem | 1g | 7333.89 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
9H-fluoren-9-ylmethyl 3-bromo-4-oxopiperidine-1-carboxylate (CAS 562827-16-1) is a chemical compound with the molecular formula C20H18BrNO3 and a molecular weight of 400.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl 3-bromo-4-oxopiperidine-1-carboxylate. InChIKey: AOMYTMXBSGKEDQ-UHFFFAOYSA-N.
| Molecular formula | C20H18BrNO3 |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl 3-bromo-4-oxopiperidine-1-carboxylate |
| InChIKey | AOMYTMXBSGKEDQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1=O)Br)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)