cas: 111409-79-1 — see every product listed under this CAS number, including other names
(Bromoethynyl)triisopropylsilane, 97% (CAS 111409-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619787-1G |
| cas | 111409-79-1 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 50g | 591.48 Pln | |
| Fluorochem | 100g | 981.96 Pln | |
| Fluorochem | 250g | 1867.07 Pln | |
| Fluorochem | 500g | 3059.36 Pln | |
| Fluorochem | 1kg | 5704.26 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2-bromoethynyl-tri(propan-2-yl)silane (CAS 111409-79-1) is a chemical compound with the molecular formula C11H21BrSi and a molecular weight of 261.27 g/mol. IUPAC name: 2-bromoethynyl-tri(propan-2-yl)silane. InChIKey: HNNUBQWDWJNURV-UHFFFAOYSA-N.
| Molecular formula | C11H21BrSi |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 2-bromoethynyl-tri(propan-2-yl)silane |
| InChIKey | HNNUBQWDWJNURV-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C#CBr)(C(C)C)C(C)C |
Computed by PubChem (NCBI)