(E)-(4-Bromostyryl)boronic acid, 97%
cas: 1795770-81-8 — see every product listed under this CAS number, including other names
(E)-(4-Bromostyryl)boronic acid, 97% (CAS 1795770-81-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A103564-100mg |
| cas | 1795770-81-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 782.00 Pln | |
| Ambeed | 250mg | 1316.00 Pln | |
| Ambeed | 1g | 3324.06 Pln | |
| Ambeed | 5g | 10494.12 Pln | |
| BLDpharm | 50mg | 547.61 Pln | |
| BLDpharm | 100mg | 841.95 Pln | |
| BLDpharm | 250mg | 1408.42 Pln | |
| BLDpharm | 1g | 3579.88 Pln | |
| BLDpharm | 5g | 11310.49 Pln | |
| Chemat | 50mg | 381.20 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2267.60 Pln | |
| Chemat | 5g | 7499.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[(E)-2-(4-bromophenyl)ethenyl]boronic acid (CAS 1795770-81-8) is a chemical compound with the molecular formula C8H8BBrO2 and a molecular weight of 226.86 g/mol. IUPAC name: [(E)-2-(4-bromophenyl)ethenyl]boronic acid. InChIKey: JWSAFHMKCACYLQ-AATRIKPKSA-N.
| Molecular formula | C8H8BBrO2 |
|---|---|
| Molecular weight | 226.86 g/mol |
| IUPAC name | [(E)-2-(4-bromophenyl)ethenyl]boronic acid |
| InChIKey | JWSAFHMKCACYLQ-AATRIKPKSA-N |
| SMILES | B(/C=C/C1=CC=C(C=C1)Br)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(E)-(4-Bromostyryl)boronic acid, (4-Bromostyryl)boronicacid, [2-(4-bromophenyl)ethenyl]boronic acid, [(E)-2-(4-bromophenyl)ethenyl]boronicacid, [(E)-2-(4-bromophenyl)ethenyl]boronic acid, (4-Bromostyryl)boronic acid, [(E)-2-(4-bromophenyl)vinyl]boronic acid, (E)-(4-Bromostyryl)Boronic acid - [B90356], B-[(1E)-2-(4-Bromophenyl)ethenyl]boronic acid, Boronic acid, B-[(1E)-2-(4-bromophenyl)ethenyl]-