cas: 4109-58-4 — see every product listed under this CAS number, including other names
(E)-1,2-Di(pyridin-2-yl)diazene 98% (CAS 4109-58-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A985038-100mg |
| cas | 4109-58-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2167.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A985038 |
Dipyridin-2-yldiazene (CAS 4109-58-4) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: dipyridin-2-yldiazene. InChIKey: VJTJVFFICHLTKX-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | dipyridin-2-yldiazene |
| InChIKey | VJTJVFFICHLTKX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N=NC2=CC=CC=N2 |
Computed by PubChem (NCBI)