CAS 71337-53-6 appears in our catalog under these names: 1,4-Bis(2,4-dibromo-6-carboxyphenyl) (2E)-2-butenedioate, 97%, 97%, (E)-2,2'-(Fumaroylbis(oxy))bis(3,5-dibromobenzoic acid), 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 2.5g, 10g.
3,5-dibromo-2-[(E)-4-(2,4-dibromo-6-carboxyphenoxy)-4-oxobut-2-enoyl]oxybenzoic acid (CAS 71337-53-6) is a chemical compound with the molecular formula C18H8Br4O8 and a molecular weight of 671.9 g/mol. IUPAC name: 3,5-dibromo-2-[(E)-4-(2,4-dibromo-6-carboxyphenoxy)-4-oxobut-2-enoyl]oxybenzoic acid. InChIKey: INZBQWPDNWVYFR-OWOJBTEDSA-N.
| Molecular formula | C18H8Br4O8 |
|---|---|
| Molecular weight | 671.9 g/mol |
| IUPAC name | 3,5-dibromo-2-[(E)-4-(2,4-dibromo-6-carboxyphenoxy)-4-oxobut-2-enoyl]oxybenzoic acid |
| InChIKey | INZBQWPDNWVYFR-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)OC(=O)/C=C/C(=O)OC2=C(C=C(C=C2Br)Br)C(=O)O)Br)Br |
Computed by PubChem (NCBI)