cas: 504433-86-7 — see every product listed under this CAS number, including other names
(E)-2-(4-Fluorostyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97% (CAS 504433-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A236649-100mg |
| cas | 504433-86-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 1616.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A236649 |
2-[(E)-2-(4-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 504433-86-7) is a chemical compound with the molecular formula C14H18BFO2 and a molecular weight of 248.10 g/mol. IUPAC name: 2-[(E)-2-(4-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZJRAXVMUDOVAOD-MDZDMXLPSA-N.
| Molecular formula | C14H18BFO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-[(E)-2-(4-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZJRAXVMUDOVAOD-MDZDMXLPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)