cas: 40739-81-9 — see every product listed under this CAS number, including other names
(E)-4-methyl-N'-(4-methylbenzylidene)benzenesulfonohydrazide (CAS 40739-81-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F749945-1G |
| cas | 40739-81-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3569.59 Pln | |
| Fluorochem | 5g | 10587.96 Pln |
| delivery time | 3-4 weeks |
|---|
4-methyl-N-[(E)-(4-methylphenyl)methylideneamino]benzenesulfonamide (CAS 40739-81-9) is a chemical compound with the molecular formula C15H16N2O2S and a molecular weight of 288.4 g/mol. IUPAC name: 4-methyl-N-[(E)-(4-methylphenyl)methylideneamino]benzenesulfonamide. InChIKey: ZCEQOHNBFVBUNC-LFIBNONCSA-N.
| Molecular formula | C15H16N2O2S |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-methyl-N-[(E)-(4-methylphenyl)methylideneamino]benzenesulfonamide |
| InChIKey | ZCEQOHNBFVBUNC-LFIBNONCSA-N |
| SMILES | CC1=CC=C(C=C1)/C=N/NS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)