cas: 36700-39-7 — see every product listed under this CAS number, including other names
(E)-N-(3-Methylaminopropyl)-2-thiopheneacrylamide, 95%, 95% (CAS 36700-39-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C0D4-10mg |
| cas | 36700-39-7 |
| size | 10mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 2843.60 Pln | |
| Chemat | 25mg | 4821.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(E)-N-[3-(methylamino)propyl]-3-thiophen-2-ylprop-2-enamide (CAS 36700-39-7) is a chemical compound with the molecular formula C11H16N2OS and a molecular weight of 224.32 g/mol. IUPAC name: (E)-N-[3-(methylamino)propyl]-3-thiophen-2-ylprop-2-enamide. InChIKey: NQKWXBJGZHHURS-AATRIKPKSA-N.
| Molecular formula | C11H16N2OS |
|---|---|
| Molecular weight | 224.32 g/mol |
| IUPAC name | (E)-N-[3-(methylamino)propyl]-3-thiophen-2-ylprop-2-enamide |
| InChIKey | NQKWXBJGZHHURS-AATRIKPKSA-N |
| SMILES | CNCCCNC(=O)/C=C/C1=CC=CS1 |
Computed by PubChem (NCBI)