cas: 1218790-50-1 — see every product listed under this CAS number, including other names
(E)-n-Cyclohexyl-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanimine, 95% (CAS 1218790-50-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691684-1G |
| cas | 1218790-50-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 945.52 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N-cyclohexyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (CAS 1218790-50-1) is a chemical compound with the molecular formula C19H28BNO2 and a molecular weight of 313.2 g/mol. IUPAC name: N-cyclohexyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine. InChIKey: BAVKTLABAAKQAH-UHFFFAOYSA-N.
| Molecular formula | C19H28BNO2 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | N-cyclohexyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| InChIKey | BAVKTLABAAKQAH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=NC3CCCCC3 |
Computed by PubChem (NCBI)