cas: 139592-37-3 — see every product listed under this CAS number, including other names
(Fmoc-Cys-OtBu)2 97% (CAS 139592-37-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A126254-250mg |
| cas | 139592-37-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 431.56 Pln | |
| Ambeed | 25g | 604.00 Pln | |
| Ambeed | 100g | 1944.56 Pln | |
| Ambeed | 500g | 7568.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A126254 |
Tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]disulfanyl]propanoate (CAS 139592-37-3) is a chemical compound with the molecular formula C44H48N2O8S2 and a molecular weight of 797.0 g/mol. IUPAC name: tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]disulfanyl]propanoate. InChIKey: IQCNHOFZFYLKLF-UWXQCODUSA-N.
| Molecular formula | C44H48N2O8S2 |
|---|---|
| Molecular weight | 797.0 g/mol |
| IUPAC name | tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]disulfanyl]propanoate |
| InChIKey | IQCNHOFZFYLKLF-UWXQCODUSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CSSC[C@@H](C(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)