cas: 1952360-91-6 — see every product listed under this CAS number, including other names
(Fmoc-amino)-PEG12-C2-Carboxylic Acid, 98%, 98% (CAS 1952360-91-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 250g, 1kg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNE5-10g |
| cas | 1952360-91-6 |
| size | 10g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 50g | 4130.00 Pln | |
| Chemat | 250g | 13048.40 Pln | |
| Chemat | 1kg | 48909.20 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 650.00 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 100g | 6957.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1952360-91-6) is a chemical compound with the molecular formula C42H65NO16 and a molecular weight of 840.0 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: JYNHRDJTWNEGJE-UHFFFAOYSA-N.
| Molecular formula | C42H65NO16 |
|---|---|
| Molecular weight | 840.0 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | JYNHRDJTWNEGJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)