cas: 5525-95-1 — see every product listed under this CAS number, including other names
(Perfluorophenyl)diphenylphosphine, 97%, 97% (CAS 5525-95-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PP8-100mg |
| cas | 5525-95-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 1010.00 Pln | |
| Chemat | 10g | 1576.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,3,4,5,6-pentafluorophenyl)-diphenylphosphane (CAS 5525-95-1) is a chemical compound with the molecular formula C18H10F5P and a molecular weight of 352.2 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl)-diphenylphosphane. InChIKey: KUTXTUCJQJPJBH-UHFFFAOYSA-N.
| Molecular formula | C18H10F5P |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl)-diphenylphosphane |
| InChIKey | KUTXTUCJQJPJBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)