cas: 113216-88-9 — see every product listed under this CAS number, including other names
(R)-((1S,2S,4S,5R)-5-Ethylquinuclidin-2-yl)(6-methoxyquinolin-4-yl)methyl 4-chlorobenzoate, 97% (CAS 113216-88-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A987129-250mg |
| cas | 113216-88-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 4558.94 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1192.40 Pln | |
| Chemat | 5g | 4576.40 Pln | |
| BLDpharm | 100mg | 286.59 Pln | |
| BLDpharm | 250mg | 464.31 Pln | |
| BLDpharm | 1g | 1280.68 Pln | |
| BLDpharm | 5g | 4907.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
[(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-chlorobenzoate (CAS 113216-88-9) is a chemical compound with the molecular formula C27H29ClN2O3 and a molecular weight of 465.0 g/mol. IUPAC name: [(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-chlorobenzoate. InChIKey: TXVNNFDXQZFMBQ-MFQNCIFPSA-N.
| Molecular formula | C27H29ClN2O3 |
|---|---|
| Molecular weight | 465.0 g/mol |
| IUPAC name | [(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] 4-chlorobenzoate |
| InChIKey | TXVNNFDXQZFMBQ-MFQNCIFPSA-N |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](C3=C4C=C(C=CC4=NC=C3)OC)OC(=O)C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)