cas: 397246-14-9 — see every product listed under this CAS number, including other names
(R)-(+)-2-(BOC-Amino)-1,4-butanediol, 97% (CAS 397246-14-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 435570050 |
| cas | 397246-14-9 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 743.89 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 857.01 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Tert-butyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate (CAS 397246-14-9) is a chemical compound with the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. IUPAC name: tert-butyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate. InChIKey: KLRRFBSWOIUAHZ-SSDOTTSWSA-N.
| Molecular formula | C9H19NO4 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1,4-dihydroxybutan-2-yl]carbamate |
| InChIKey | KLRRFBSWOIUAHZ-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCO)CO |
Computed by PubChem (NCBI)