(R)-1,1'-Binaphthyl-2,2'-diyl hydrogen phosphate, 97%, 97%
cas: 39648-67-4 — see every product listed under this CAS number, including other names
(R)-1,1'-Binaphthyl-2,2'-diyl hydrogen phosphate, 97%, 97% (CAS 39648-67-4) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 5kg, 10kg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140DT-50g |
| cas | 39648-67-4 |
| size | 50g |
| availability | 25000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 174.80 Pln | |
| Chemat | 250g | 611.60 Pln | |
| Chemat | 5kg | 11169.60 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 280.40 Pln | |
| Chemat | 500g | 1228.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
13-oxido-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (CAS 39648-67-4) is a chemical compound with the molecular formula C20H12O4P- and a molecular weight of 347.3 g/mol. IUPAC name: 13-oxido-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide. InChIKey: JEHUZVBIUCAMRZ-UHFFFAOYSA-M.
| Molecular formula | C20H12O4P- |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 13-oxido-12,14-dioxa-13lambda5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| InChIKey | JEHUZVBIUCAMRZ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(C=CC5=CC=CC=C54)OP(=O)(O3)[O-] |
Computed by PubChem (NCBI)