(R)-1,12-Bis(diphenylphosphanyl)-6,7-diphenyldibenzo[e,g][1,4]diazocine, 98%
cas: 2648055-15-4 — see every product listed under this CAS number, including other names
(R)-1,12-Bis(diphenylphosphanyl)-6,7-diphenyldibenzo[e,g][1,4]diazocine, 98% (CAS 2648055-15-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1597854-250mg |
| cas | 2648055-15-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2995.88 Pln | |
| Ambeed | 1g | 7640.56 Pln | |
| BLDpharm | 50mg | 1175.17 Pln | |
| BLDpharm | 100mg | 1852.71 Pln | |
| BLDpharm | 250mg | 3224.44 Pln | |
| BLDpharm | 1g | 8233.79 Pln | |
| Chemat | 50mg | 827.60 Pln | |
| Chemat | 100mg | 1360.40 Pln | |
| Fluorochem | 50mg | 1539.06 Pln | |
| Fluorochem | 100mg | 2523.09 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(16-diphenylphosphanyl-9,10-diphenyl-8,11-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,8,10,13,15-octaen-3-yl)-diphenylphosphane (CAS 2648055-15-4) is a chemical compound with the molecular formula C50H36N2P2 and a molecular weight of 726.8 g/mol. IUPAC name: (16-diphenylphosphanyl-9,10-diphenyl-8,11-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,8,10,13,15-octaen-3-yl)-diphenylphosphane. InChIKey: MAKAWLNABLRMBV-UHFFFAOYSA-N.
| Molecular formula | C50H36N2P2 |
|---|---|
| Molecular weight | 726.8 g/mol |
| IUPAC name | (16-diphenylphosphanyl-9,10-diphenyl-8,11-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2(7),3,5,8,10,13,15-octaen-3-yl)-diphenylphosphane |
| InChIKey | MAKAWLNABLRMBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C(=CC=C3)P(C4=CC=CC=C4)C5=CC=CC=C5)C6=C(C=CC=C6P(C7=CC=CC=C7)C8=CC=CC=C8)N=C2C9=CC=CC=C9 |
Computed by PubChem (NCBI)
Synonyms:
(R)-1,12-Bis(diphenylphosphanyl)-6,7-diphenyldibenzo[e,g][1,4]diazocine, (S)-1,12-Bis(diphenylphosphanyl)-6,7-diphenyldibenzo[e,g][1,4]diazocine, 1,12-bis(diphenylphosphaneyl)-6,7-diphenyldibenzo[e,g][1,4]diazocine, Dibenzo[e,g][1,4]diazocine, 1,12-bis(diphenylphosphino)-6,7-diphenyl-, (12aR)-