cas: 78008-36-3 — see every product listed under this CAS number, including other names
(R)-1,4-Dioxaspiro[4.5]decane-2-carbaldehyde 98% (CAS 78008-36-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A225451-250mg |
| cas | 78008-36-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A225451 |
(3R)-1,4-dioxaspiro[4.5]decane-3-carbaldehyde (CAS 78008-36-3) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: (3R)-1,4-dioxaspiro[4.5]decane-3-carbaldehyde. InChIKey: FFGZPNNLXMQFMO-QMMMGPOBSA-N.
| Molecular formula | C9H14O3 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | (3R)-1,4-dioxaspiro[4.5]decane-3-carbaldehyde |
| InChIKey | FFGZPNNLXMQFMO-QMMMGPOBSA-N |
| SMILES | C1CCC2(CC1)OC[C@@H](O2)C=O |
Computed by PubChem (NCBI)