CAS 856563-10-5 is the registry number for (R)-1-(2,4-Dimethylphenyl)ethan-1-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(2,4-dimethylphenyl)ethanamine (CAS 856563-10-5) is a chemical compound with the molecular formula C10H15N and a molecular weight of 149.23 g/mol. IUPAC name: (1R)-1-(2,4-dimethylphenyl)ethanamine. InChIKey: LFJDRMQPKZCUNL-SECBINFHSA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 149.23 g/mol |
| IUPAC name | (1R)-1-(2,4-dimethylphenyl)ethanamine |
| InChIKey | LFJDRMQPKZCUNL-SECBINFHSA-N |
| SMILES | CC1=CC(=C(C=C1)[C@@H](C)N)C |
Computed by PubChem (NCBI)