cas: 870849-57-3 — see every product listed under this CAS number, including other names
(R)-1-(4-Fluoro-3-methoxyphenyl)ethan-1-ol, 95% (CAS 870849-57-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F677331-50MG |
| cas | 870849-57-3 |
| size | 50mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1086.09 Pln | |
| Fluorochem | 100mg | 1591.12 Pln | |
| Fluorochem | 250mg | 2231.52 Pln | |
| Fluorochem | 500mg | 3444.64 Pln | |
| Fluorochem | 1g | 4397.43 Pln | |
| Fluorochem | 2.5g | 8401.23 Pln | |
| Fluorochem | 5g | 12394.61 Pln | |
| Chemat | 50mg | 813.20 Pln | |
| Chemat | 100mg | 1182.80 Pln | |
| Chemat | 250mg | 1662.80 Pln | |
| Chemat | 500mg | 2584.40 Pln | |
| Chemat | 1g | 3294.80 Pln | |
| Chemat | 5g | 9429.20 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(1R)-1-(4-fluoro-3-methoxyphenyl)ethanol (CAS 870849-57-3) is a chemical compound with the molecular formula C9H11FO2 and a molecular weight of 170.18 g/mol. IUPAC name: (1R)-1-(4-fluoro-3-methoxyphenyl)ethanol. InChIKey: OGBGGCJKDXCBGP-ZCFIWIBFSA-N.
| Molecular formula | C9H11FO2 |
|---|---|
| Molecular weight | 170.18 g/mol |
| IUPAC name | (1R)-1-(4-fluoro-3-methoxyphenyl)ethanol |
| InChIKey | OGBGGCJKDXCBGP-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)F)OC)O |
Computed by PubChem (NCBI)