cas: 2166008-44-0 — see every product listed under this CAS number, including other names
(R)-1-(TERT-BUTOXYCARBONYL)-4,4-DIFLUOROPIPERIDINE-2-CARBOXYLIC ACID, 98% (CAS 2166008-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F850386-100MG |
| cas | 2166008-44-0 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 888.25 Pln | |
| Fluorochem | 250mg | 1492.20 Pln | |
| Fluorochem | 500mg | 1664.02 Pln | |
| Fluorochem | 1g | 2762.59 Pln | |
| Fluorochem | 5g | 10270.36 Pln | |
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1106.00 Pln | |
| Chemat | 500mg | 1811.60 Pln | |
| Chemat | 1g | 2267.60 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 2166008-44-0) is a chemical compound with the molecular formula C11H17F2NO4 and a molecular weight of 265.25 g/mol. IUPAC name: (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: BEYLYGCFFXJNQM-SSDOTTSWSA-N.
| Molecular formula | C11H17F2NO4 |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | BEYLYGCFFXJNQM-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C[C@@H]1C(=O)O)(F)F |
Computed by PubChem (NCBI)