cas: 1407991-22-3 — see every product listed under this CAS number, including other names
(R)-1-Boc-2-(hydroxymethyl)-4,4-difluoropyrrolidin, 97%, 97% (CAS 1407991-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CRQ-100mg |
| cas | 1407991-22-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 654.80 Pln | |
| Chemat | 500mg | 1048.40 Pln | |
| Chemat | 1g | 1542.80 Pln | |
| Chemat | 5g | 4514.00 Pln | |
| Chemat | 10g | 7490.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 1407991-22-3) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl (2R)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: KQLZXWXCBWPDAD-SSDOTTSWSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl (2R)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | KQLZXWXCBWPDAD-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@@H]1CO)(F)F |
Computed by PubChem (NCBI)