(R)-2-(2-(Bis(3,5-bis(trifluoromethyl)phenyl)phosphino)phenyl)-4-isopropyl-4,5-dihydrooxazole, 97%
cas: 2828432-30-8 — see every product listed under this CAS number, including other names
(R)-2-(2-(Bis(3,5-bis(trifluoromethyl)phenyl)phosphino)phenyl)-4-isopropyl-4,5-dihydrooxazole, 97% (CAS 2828432-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1363107-100mg |
| cas | 2828432-30-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1388.31 Pln | |
| Ambeed | 250mg | 2317.25 Pln | |
| Ambeed | 1g | 5821.62 Pln | |
| Chemat | 50mg | 645.20 Pln | |
| Chemat | 100mg | 1053.20 Pln | |
| Chemat | 250mg | 1744.40 Pln | |
| Chemat | 1g | 4605.20 Pln | |
| BLDpharm | 50mg | 836.40 Pln | |
| BLDpharm | 100mg | 1363.99 Pln | |
| BLDpharm | 250mg | 2274.78 Pln | |
| BLDpharm | 1g | 5706.90 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Bis[3,5-bis(trifluoromethyl)phenyl]-[2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane (CAS 2828432-30-8) is a chemical compound with the molecular formula C28H20F12NOP and a molecular weight of 645.4 g/mol. IUPAC name: bis[3,5-bis(trifluoromethyl)phenyl]-[2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane. InChIKey: VHJNWRXTQCCFOR-QFIPXVFZSA-N.
| Molecular formula | C28H20F12NOP |
|---|---|
| Molecular weight | 645.4 g/mol |
| IUPAC name | bis[3,5-bis(trifluoromethyl)phenyl]-[2-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
| InChIKey | VHJNWRXTQCCFOR-QFIPXVFZSA-N |
| SMILES | CC(C)[C@@H]1COC(=N1)C2=CC=CC=C2P(C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)