cas: 823188-58-5 — see every product listed under this CAS number, including other names
(R)-2-(2-Chlorophenyl)pyrrolidine (CAS 823188-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116FE6-100mg |
| cas | 823188-58-5 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 698.00 Pln |
| delivery time | 3 weeks |
|---|
(2R)-2-(2-chlorophenyl)pyrrolidine (CAS 823188-58-5) is a chemical compound with the molecular formula C10H12ClN and a molecular weight of 181.66 g/mol. IUPAC name: (2R)-2-(2-chlorophenyl)pyrrolidine. InChIKey: AFXDPDJNNABZGP-SNVBAGLBSA-N.
| Molecular formula | C10H12ClN |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2R)-2-(2-chlorophenyl)pyrrolidine |
| InChIKey | AFXDPDJNNABZGP-SNVBAGLBSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)