(R)-2-(6-Benzhydrylpyridin-2-yl)-4-cyclohexyl-4,5-dihydrooxazole, 97%
cas: 2828438-57-7 — see every product listed under this CAS number, including other names
(R)-2-(6-Benzhydrylpyridin-2-yl)-4-cyclohexyl-4,5-dihydrooxazole, 97% (CAS 2828438-57-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1519854-100mg |
| cas | 2828438-57-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 631.81 Pln | |
| Ambeed | 250mg | 1032.31 Pln | |
| Ambeed | 1g | 2651.00 Pln | |
| Ambeed | 5g | 10533.06 Pln | |
| Chemat | 100mg | 798.80 Pln | |
| Chemat | 250mg | 1312.40 Pln | |
| Chemat | 1g | 3429.20 Pln | |
| BLDpharm | 100mg | 675.34 Pln | |
| BLDpharm | 250mg | 1108.52 Pln | |
| BLDpharm | 1g | 2852.35 Pln | |
| BLDpharm | 5g | 11349.36 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4R)-2-(6-benzhydryl-2-pyridinyl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole (CAS 2828438-57-7) is a chemical compound with the molecular formula C27H28N2O and a molecular weight of 396.5 g/mol. IUPAC name: (4R)-2-(6-benzhydryl-2-pyridinyl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole. InChIKey: TVHFQDPOEWAYCX-VWLOTQADSA-N.
| Molecular formula | C27H28N2O |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | (4R)-2-(6-benzhydryl-2-pyridinyl)-4-cyclohexyl-4,5-dihydro-1,3-oxazole |
| InChIKey | TVHFQDPOEWAYCX-VWLOTQADSA-N |
| SMILES | C1CCC(CC1)[C@@H]2COC(=N2)C3=NC(=CC=C3)C(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-(6-Benzhydrylpyridin-2-yl)-4-cyclohexyl-4,5-dihydrooxazole, (4R)-2-(6-benzhydryl-2-pyridyl)-4-cyclohexyl-4,5-dihydrooxazole, (R)-2-(6-Benzhydryl-2-pyridyl)-4-cyclohexyl-4,5-dihydrooxazole, 2-[(4R)-4-Cyclohexyl-4,5-dihydro-2-oxazolyl]-6-(diphenylmethyl)pyridine, Pyridine, 2-[(4R)-4-cyclohexyl-4,5-dihydro-2-oxazolyl]-6-(diphenylmethyl)-