cas: 1174913-80-4 — see every product listed under this CAS number, including other names
(R)-2-Aminomethyl-4-Boc-morpholine, 97% (CAS 1174913-80-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221741-100MG |
| cas | 1174913-80-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1101.71 Pln | |
| Fluorochem | 10g | 2153.43 Pln | |
| Fluorochem | 25g | 5287.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate (CAS 1174913-80-4) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate. InChIKey: MTMBHUYOIZWQAJ-MRVPVSSYSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (2R)-2-(aminomethyl)morpholine-4-carboxylate |
| InChIKey | MTMBHUYOIZWQAJ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C1)CN |
Computed by PubChem (NCBI)