(R)-2-Methyl-1,1'-binaphthalene, 98%
cas: 118018-44-3 — see every product listed under this CAS number, including other names
(R)-2-Methyl-1,1'-binaphthalene, 98% (CAS 118018-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1270740-100mg |
| cas | 118018-44-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 971.12 Pln | |
| Ambeed | 250mg | 1621.94 Pln | |
| Ambeed | 1g | 4180.69 Pln | |
| Chemat | 50mg | 462.80 Pln | |
| Chemat | 100mg | 741.20 Pln | |
| Chemat | 250mg | 1211.60 Pln | |
| Chemat | 1g | 3165.20 Pln | |
| BLDpharm | 50mg | 569.82 Pln | |
| BLDpharm | 100mg | 947.47 Pln | |
| BLDpharm | 250mg | 1586.13 Pln | |
| BLDpharm | 1g | 4096.36 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-methyl-1-naphthalen-1-ylnaphthalene (CAS 118018-44-3) is a chemical compound with the molecular formula C21H16 and a molecular weight of 268.4 g/mol. IUPAC name: 2-methyl-1-naphthalen-1-ylnaphthalene. InChIKey: YJFPWGKKKSWQKZ-UHFFFAOYSA-N.
| Molecular formula | C21H16 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 2-methyl-1-naphthalen-1-ylnaphthalene |
| InChIKey | YJFPWGKKKSWQKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C=C1)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)