cas: 376594-67-1 — see every product listed under this CAS number, including other names
(R)-3,5-Difluoro-N-(4-(1-(1-methylethylsulfonamido)propan-2-yl)phenyl)benzamide, 99.91% ,, 99.91% , (CAS 376594-67-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 25mg, 100mg, 5mg, 10mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7G0-1mg |
| cas | 376594-67-1 |
| size | 1mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 213.20 Pln | |
| Chemat | 25mg | 1034.00 Pln | |
| Chemat | 100mg | 1960.40 Pln | |
| Chemat | 5mg | 429.20 Pln | |
| Chemat | 10mg | 635.60 Pln | |
| Chemat | 50mg | 1413.20 Pln |
| purity | 99.91% , |
|---|---|
| delivery time | 3 weeks |
3,5-difluoro-N-[4-[(2R)-1-(propan-2-ylsulfonylamino)propan-2-yl]phenyl]benzamide (CAS 376594-67-1) is a chemical compound with the molecular formula C19H22F2N2O3S and a molecular weight of 396.5 g/mol. IUPAC name: 3,5-difluoro-N-[4-[(2R)-1-(propan-2-ylsulfonylamino)propan-2-yl]phenyl]benzamide. InChIKey: ACOXQYLJOQAHST-ZDUSSCGKSA-N.
| Molecular formula | C19H22F2N2O3S |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | 3,5-difluoro-N-[4-[(2R)-1-(propan-2-ylsulfonylamino)propan-2-yl]phenyl]benzamide |
| InChIKey | ACOXQYLJOQAHST-ZDUSSCGKSA-N |
| SMILES | C[C@@H](CNS(=O)(=O)C(C)C)C1=CC=C(C=C1)NC(=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)