cas: 168466-84-0 — see every product listed under this CAS number, including other names
(R)-3-Amino-1-benzyl-piperidine, 97% (CAS 168466-84-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040432-1G |
| cas | 168466-84-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 778.91 Pln | |
| Fluorochem | 25g | 1528.65 Pln | |
| Fluorochem | 100g | 4532.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-1-benzylpiperidin-3-amine (CAS 168466-84-0) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (3R)-1-benzylpiperidin-3-amine. InChIKey: HARWNWOLWMTQCC-GFCCVEGCSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (3R)-1-benzylpiperidin-3-amine |
| InChIKey | HARWNWOLWMTQCC-GFCCVEGCSA-N |
| SMILES | C1C[C@H](CN(C1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)