(R)-4-(Pyrrolidin-3-yl)thiomorpholine dihydrochloride, 95%
cas: 1821825-02-8 — see every product listed under this CAS number, including other names
(R)-4-(Pyrrolidin-3-yl)thiomorpholine dihydrochloride, 95% (CAS 1821825-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F865345-100MG |
| cas | 1821825-02-8 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 1099.06 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 1175.17 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1278.80 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-[(3R)-pyrrolidin-3-yl]thiomorpholine;dihydrochloride (CAS 1821825-02-8) is a chemical compound with the molecular formula C8H18Cl2N2S and a molecular weight of 245.21 g/mol. IUPAC name: 4-[(3R)-pyrrolidin-3-yl]thiomorpholine;dihydrochloride. InChIKey: XETVELRYQVEVGK-YCBDHFTFSA-N.
| Molecular formula | C8H18Cl2N2S |
|---|---|
| Molecular weight | 245.21 g/mol |
| IUPAC name | 4-[(3R)-pyrrolidin-3-yl]thiomorpholine;dihydrochloride |
| InChIKey | XETVELRYQVEVGK-YCBDHFTFSA-N |
| SMILES | C1CNC[C@@H]1N2CCSCC2.Cl.Cl |
Computed by PubChem (NCBI)