(R)-4-Benzyl-2-(2-(diphenylphosphino)benzyl)-4,5-dihydrooxazole, 97%
cas: 2901043-37-4 — see every product listed under this CAS number, including other names
(R)-4-Benzyl-2-(2-(diphenylphosphino)benzyl)-4,5-dihydrooxazole, 97% (CAS 2901043-37-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1475108-100mg |
| cas | 2901043-37-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1126.88 Pln | |
| Ambeed | 250mg | 1672.00 Pln | |
| Ambeed | 1g | 3891.44 Pln | |
| Ambeed | 5g | 15122.13 Pln | |
| BLDpharm | 50mg | 758.65 Pln | |
| BLDpharm | 100mg | 1108.52 Pln | |
| BLDpharm | 250mg | 1641.67 Pln | |
| BLDpharm | 1g | 3813.13 Pln | |
| BLDpharm | 5g | 14831.47 Pln | |
| Chemat | 250mg | 1418.00 Pln | |
| Chemat | 1g | 3453.20 Pln | |
| Chemat | 5g | 13010.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-[[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]-diphenylphosphane (CAS 2901043-37-4) is a chemical compound with the molecular formula C29H26NOP and a molecular weight of 435.5 g/mol. IUPAC name: [2-[[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]-diphenylphosphane. InChIKey: DUGMNGBDTQMIDH-RUZDIDTESA-N.
| Molecular formula | C29H26NOP |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | [2-[[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]-diphenylphosphane |
| InChIKey | DUGMNGBDTQMIDH-RUZDIDTESA-N |
| SMILES | C1[C@H](N=C(O1)CC2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)