cas: 62566-68-1 — see every product listed under this CAS number, including other names
(R)-4-Bromostyrene oxide (CAS 62566-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037022-250MG |
| cas | 62566-68-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 2939.61 Pln | |
| Fluorochem | 5g | 13914.91 Pln | |
| Fluorochem | 10g | 23146.03 Pln |
| delivery time | 3-4 weeks |
|---|
(2R)-2-(4-bromophenyl)oxirane (CAS 62566-68-1) is a chemical compound with the molecular formula C8H7BrO and a molecular weight of 199.04 g/mol. IUPAC name: (2R)-2-(4-bromophenyl)oxirane. InChIKey: NNINSLOEPXEZOZ-QMMMGPOBSA-N.
| Molecular formula | C8H7BrO |
|---|---|
| Molecular weight | 199.04 g/mol |
| IUPAC name | (2R)-2-(4-bromophenyl)oxirane |
| InChIKey | NNINSLOEPXEZOZ-QMMMGPOBSA-N |
| SMILES | C1[C@H](O1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)