(R)-4-Isobutyl-2-(pyridin-2-ylmethyl)-4,5-dihydrooxazole, 97%
cas: 2757085-19-9 — see every product listed under this CAS number, including other names
(R)-4-Isobutyl-2-(pyridin-2-ylmethyl)-4,5-dihydrooxazole, 97% (CAS 2757085-19-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1496228-250mg |
| cas | 2757085-19-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1688.69 Pln | |
| Ambeed | 5g | 6611.50 Pln | |
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1768.40 Pln | |
| BLDpharm | 100mg | 336.57 Pln | |
| BLDpharm | 250mg | 603.15 Pln | |
| BLDpharm | 1g | 1658.33 Pln | |
| BLDpharm | 5g | 6451.09 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4R)-4-(2-methylpropyl)-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole (CAS 2757085-19-9) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: (4R)-4-(2-methylpropyl)-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole. InChIKey: DSPZANIZLCBYRM-GFCCVEGCSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | (4R)-4-(2-methylpropyl)-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | DSPZANIZLCBYRM-GFCCVEGCSA-N |
| SMILES | CC(C)C[C@@H]1COC(=N1)CC2=CC=CC=N2 |
Computed by PubChem (NCBI)