cas: 278788-66-2 — see every product listed under this CAS number, including other names
(R)-4-N-Boc-2-hydroxymethyl-piperazine, 97% (CAS 278788-66-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040658-1G |
| cas | 278788-66-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 372.80 Pln | |
| Fluorochem | 100g | 1195.43 Pln | |
| Fluorochem | 500g | 4798.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3R)-3-(hydroxymethyl)piperazine-1-carboxylate (CAS 278788-66-2) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3R)-3-(hydroxymethyl)piperazine-1-carboxylate. InChIKey: NSILYQWHARROMG-MRVPVSSYSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3R)-3-(hydroxymethyl)piperazine-1-carboxylate |
| InChIKey | NSILYQWHARROMG-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)CO |
Computed by PubChem (NCBI)